CymitQuimica logo

CAS 113949-25-0

:

4-(2,3-Dimethoxyphenyl)-2-methyl-3-buten-2-ol

Description:
4-(2,3-Dimethoxyphenyl)-2-methyl-3-buten-2-ol, with the CAS number 113949-25-0, is an organic compound characterized by its unique structure, which includes a butenol moiety and a dimethoxy-substituted phenyl group. This compound typically exhibits properties associated with both alcohols and alkenes, such as the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group, which can influence its solubility in polar solvents. The presence of the dimethoxyphenyl group may contribute to its aromatic characteristics and potential reactivity in electrophilic substitution reactions. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its stability and reactivity can be influenced by factors such as pH and temperature, and it may undergo various transformations under different conditions. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-13(2,14)9-8-10-6-5-7-11(15-3)12(10)16-4/h5-9,14H,1-4H3
InChI key:InChIKey=NQKDOZONHBFTJF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C)(C)O)C=CC=C1OC
Synonyms:
  • 4-(2,3-Dimethoxyphenyl)-2-methyl-3-buten-2-ol
  • 3-Buten-2-ol, 4-(2,3-dimethoxyphenyl)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.