CAS 113949-30-7
:6,6,7-Trimethyl-6H-1,3-dioxolo[4,5-g][1]benzopyran
Description:
6,6,7-Trimethyl-6H-1,3-dioxolo[4,5-g][1]benzopyran, with the CAS number 113949-30-7, is a synthetic organic compound that belongs to the class of benzopyrans, which are characterized by their fused benzene and pyran rings. This compound features a dioxole moiety, contributing to its unique structural properties. It typically exhibits a complex aromatic character due to the presence of multiple methyl groups, which can influence its solubility and reactivity. The presence of the dioxole ring may enhance its stability and potentially impart interesting electronic properties. Such compounds are often studied for their biological activities, including antioxidant and anti-inflammatory effects, making them of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, leading to varied pharmacological profiles. Overall, 6,6,7-trimethyl-6H-1,3-dioxolo[4,5-g][1]benzopyran represents a fascinating area of study within organic and medicinal chemistry.
Formula:C13H14O3
InChI:InChI=1S/C13H14O3/c1-8-4-9-5-11-12(15-7-14-11)6-10(9)16-13(8,2)3/h4-6H,7H2,1-3H3
InChI key:InChIKey=SPGPZJVBCJJVMN-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C3C(=C2)OCO3)OC1(C)C
Synonyms:- 6,6,7-Trimethyl-6H-1,3-dioxolo[4,5-g][1]benzopyran
- 6H-1,3-Dioxolo[4,5-g][1]benzopyran, 6,6,7-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
