CAS 113949-37-4
:methyl (4S)-4-phenoxy-L-prolinate
Description:
Methyl (4S)-4-phenoxy-L-prolinate, with the CAS number 113949-37-4, is an organic compound characterized by its proline derivative structure. It features a proline backbone, which is an amino acid known for its cyclic structure and role in protein synthesis. The "4S" designation indicates the specific stereochemistry at the fourth carbon, which is crucial for its biological activity. The presence of a phenoxy group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. This compound may exhibit properties typical of proline derivatives, such as involvement in peptide synthesis or as a chiral building block in organic synthesis. Its methyl ester form suggests it may have enhanced lipophilicity, which can affect its pharmacokinetics and bioavailability. Overall, methyl (4S)-4-phenoxy-L-prolinate is of interest in medicinal chemistry and biochemistry, particularly for its potential applications in drug development and as a biochemical tool.
Formula:C12H15NO3
InChI:InChI=1/C12H15NO3/c1-15-12(14)11-7-10(8-13-11)16-9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3/t10-,11-/m0/s1
SMILES:COC(=O)[C@@H]1C[C@@H](CN1)Oc1ccccc1
Synonyms:- L-proline, 4-phenoxy-, methyl ester, (4S)-
- Methyl (4S)-4-phenoxy-L-prolinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
