CAS 113952-21-9
:(11-carbamoyl-5-oxo-6H-benzo[b][1]benzazepin-6-yl) acetate
Description:
(11-Carbamoyl-5-oxo-6H-benzo[b][1]benzazepin-6-yl) acetate, with the CAS number 113952-21-9, is a chemical compound that belongs to the class of benzazepines, which are characterized by a fused benzene and azepine ring structure. This compound features a carbamoyl group and an acetyl group, contributing to its potential biological activity. The presence of the carbonyl and amide functionalities suggests that it may exhibit properties such as hydrogen bonding and potential reactivity in various chemical environments. Its structural complexity may influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry. Compounds of this nature are often investigated for their pharmacological properties, including potential applications in treating neurological or psychiatric disorders. However, specific biological activity, toxicity, and pharmacokinetic profiles would require further empirical studies to elucidate its full potential and safety profile.
Formula:C17H14N2O4
InChI:InChI=1/C17H14N2O4/c1-10(20)23-16-12-7-3-5-9-14(12)19(17(18)22)13-8-4-2-6-11(13)15(16)21/h2-9,16H,1H3,(H2,18,22)
SMILES:CC(=O)OC1c2ccccc2N(c2ccccc2C1=O)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
5H-Dibenz[b,f]azepine-5-carboxamide, 10-(acetyloxy)-10,11-dihydro-11-oxo-
CAS:Formula:C17H14N2O4Color and Shape:SolidMolecular weight:310.304110-Acetyloxy Oxcarbazepine
CAS:Controlled ProductApplications An intermediate in the preparation of Carbamazepine metabolites.
References Heckendorn, R., et al.: Helv. Chimica Acta, 70, 1955 (1987),Formula:C17H14N2O4Color and Shape:NeatMolecular weight:310.3



