CAS 113961-70-9
:1-(2-chloro-4-pyridyl)butan-1-one
Description:
1-(2-Chloro-4-pyridyl)butan-1-one, with the CAS number 113961-70-9, is an organic compound characterized by its pyridine ring and a butanone functional group. This compound features a chloro substituent at the 2-position of the pyridine ring, which contributes to its reactivity and potential biological activity. The presence of the butanone moiety indicates that it has a ketone functional group, which can participate in various chemical reactions, such as nucleophilic additions. The compound is likely to be a solid or liquid at room temperature, depending on its specific structural attributes and purity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often found in biologically active compounds. Additionally, the chlorine atom may enhance the compound's lipophilicity and influence its interaction with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C9H10ClNO
InChI:InChI=1/C9H10ClNO/c1-2-3-8(12)7-4-5-11-9(10)6-7/h4-6H,2-3H2,1H3
SMILES:CCCC(=O)c1ccnc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.