
CAS 113963-87-4
:Propanoic acid, 2-(2,4-dichlorophenoxy)-, potassium salt (1:1), (2R)-
Description:
Propanoic acid, 2-(2,4-dichlorophenoxy)-, potassium salt (1:1), (2R)-, is a chemical compound characterized by its structure, which includes a propanoic acid moiety and a 2,4-dichlorophenoxy group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the potassium salt. It exhibits properties typical of carboxylic acids, such as acidity, and can participate in various chemical reactions, including esterification and neutralization. The presence of the dichlorophenoxy group suggests potential applications in herbicides or as a plant growth regulator, as similar compounds are often used in agricultural chemistry. The specific stereochemistry indicated by (2R)- suggests that the compound has a defined spatial arrangement, which can influence its biological activity and interactions. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.
Formula:C9H8Cl2O3·K
InChI:InChI=1S/C9H8Cl2O3.K/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;/h2-5H,1H3,(H,12,13);/t5-;/m1./s1
InChI key:InChIKey=QWCKFTGJAVOPBA-NUBCRITNSA-N
SMILES:O([C@@H](C(O)=O)C)C1=C(Cl)C=C(Cl)C=C1.[K]
Synonyms:- Propanoic acid, 2-(2,4-dichlorophenoxy)-, potassium salt (1:1), (2R)-
- Propanoic acid, 2-(2,4-dichlorophenoxy)-, potassium salt, (R)-
- Duplosan DP
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propanoic acid, 2-(2,4-dichlorophenoxy)-, potassium salt (1:1), (2R)-
CAS:Formula:C9H7Cl2KO3Molecular weight:273.1544
