CAS 113967-27-4

Methyl 1,2,3,4-tetrahydro-6-methoxy-1-naphthalenecarboxylate

Description:

Methyl 1,2,3,4-tetrahydro-6-methoxy-1-naphthalenecarboxylate, with the CAS number 113967-27-4, is an organic compound characterized by its complex bicyclic structure derived from naphthalene. This substance features a methoxy group (-OCH3) and a carboxylate ester functional group, which contribute to its chemical reactivity and potential applications in organic synthesis. The tetrahydro configuration indicates the presence of four hydrogen-saturated carbon atoms, which enhances its stability compared to fully aromatic compounds. This compound is likely to exhibit moderate polarity due to the presence of the methoxy and carboxylate groups, influencing its solubility in various solvents. Additionally, it may possess interesting biological activities, making it a candidate for further research in medicinal chemistry. Its synthesis and manipulation in laboratory settings can provide insights into the behavior of similar naphthalene derivatives, potentially leading to the development of new materials or pharmaceuticals. As with any chemical substance, proper handling and safety protocols should be observed due to its potential hazards.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-15-10-6-7-11-9(8-10)4-3-5-12(11)13(14)16-2/h6-8,12H,3-5H2,1-2H3

InChI key: InChIKey=YRTALWPXMYJEHS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C=2C(=CC(OC)=CC2)CCC1

Synonyms:

• 1-Naphthalenecarboxylic acid, 1,2,3,4-tetrahydro-6-methoxy-, methyl ester
• Methyl 1,2,3,4-tetrahydro-6-methoxy-1-naphthalenecarboxylate