CAS 113967-72-9

7-Amino-2-(4-morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:

7-Amino-2-(4-morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the morpholine substituent enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their biological activities, including potential roles as pharmaceuticals or agrochemicals. The molecular structure suggests that it may interact with biological targets through hydrogen bonding and other non-covalent interactions. Its CAS number, 113967-72-9, allows for precise identification in chemical databases. Overall, this compound exemplifies the diversity of nitrogen-containing heterocycles in medicinal chemistry, with potential applications in drug development and therapeutic research.

Formula: C₁₀H₁₂N₆O₃

InChI: InChI=1S/C10H12N6O3/c11-7-6(8(17)18)5-12-9-13-10(14-16(7)9)15-1-3-19-4-2-15/h5H,1-4,11H2,(H,17,18)

InChI key: InChIKey=QWJYBIPYTIQUKH-UHFFFAOYSA-N

SMILES: NC=1N2C(=NC(=N2)N3CCOCC3)N=CC1C(O)=O

Synonyms:

• 7-Amino-2-(4-morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid
• [1,2,4]Triazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-amino-2-(4-morpholinyl)-