CAS 113967-75-2

2-(4-Morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine

Description:

2-(4-Morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is a chemical compound characterized by its unique structure, which includes a triazole ring fused to a pyrimidine moiety, along with a morpholine substituent. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the morpholine group may enhance its pharmacokinetic properties, such as membrane permeability and binding affinity to biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of agents targeting specific biological pathways. Additionally, the triazole and pyrimidine rings are known for their roles in various biological activities, including antimicrobial and anticancer properties. As with many heterocyclic compounds, the specific reactivity and stability can vary based on environmental conditions, such as pH and temperature. Overall, 2-(4-Morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine represents a class of compounds that may hold promise for further exploration in drug development.

Formula: C₉H₁₂N₆O

InChI: InChI=1S/C9H12N6O/c10-7-1-2-11-8-12-9(13-15(7)8)14-3-5-16-6-4-14/h1-2H,3-6,10H2

InChI key: InChIKey=GARXIXOTIYGABP-UHFFFAOYSA-N

SMILES: NC=1N2N=C(N=C2N=CC1)N3CCOCC3

Synonyms:

• 2-(4-Morpholinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
• [1,2,4]Triazolo[1,5-a]pyrimidin-7-amine, 2-(4-morpholinyl)-