CAS 113972-57-9
:Leukotoxin
Description:
Leukotoxin, identified by its CAS number 113972-57-9, is a potent toxic compound primarily produced by certain strains of bacteria, particularly those in the genus *Mannheimia* and *Pasteurella*. This substance is known for its ability to induce cytotoxic effects, particularly on leukocytes, which are white blood cells crucial for the immune response. Leukotoxin functions by disrupting cellular membranes, leading to cell lysis and death, which can contribute to the pathogenesis of infections caused by these bacteria. The compound is a member of the class of toxins known as pore-forming toxins, which create pores in the membranes of target cells. Its biological activity is of significant interest in both microbiology and immunology, as it can influence the severity of bacterial infections and the host's immune response. Additionally, leukotoxin's structure and mechanism of action are subjects of ongoing research, aiming to understand its role in disease and potential therapeutic applications.
Formula:C18H32O3
InChI:InChI=1S/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)
InChI key:InChIKey=FBUKMFOXMZRGRB-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)C1C(CC=CCCCCC)O1
Synonyms:- Leukotoxin
- Oxiraneoctanoic acid, 3-(2-octenyl)-
- Linoleate 8,10-epoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
