CymitQuimica logo

CAS 113974-26-8

:

1,2-Ethanediamine, 1-(2-bromophenyl)-, (S)-

Description:
1,2-Ethanediamine, 1-(2-bromophenyl)-, (S)-, with the CAS number 113974-26-8, is a chiral organic compound characterized by the presence of a bromophenyl group attached to a 1,2-ethanediamine backbone. This compound features two amine functional groups, which contribute to its potential as a ligand in coordination chemistry and catalysis. The (S)- designation indicates that it has a specific stereochemistry, which can influence its reactivity and interactions in biological systems. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to the presence of amine groups, which can engage in hydrogen bonding. The bromine substituent can also affect the compound's electronic properties and reactivity, making it useful in various synthetic applications. Additionally, the presence of both amine and aromatic functionalities suggests potential applications in pharmaceuticals and materials science, where chirality and functional group diversity are often critical for desired properties and activities.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8H,5,10-11H2/t8-/m1/s1
InChI key:InChIKey=PAMGDOWWTHYUTI-MRVPVSSYSA-N
SMILES:[C@H](CN)(N)C1=C(Br)C=CC=C1
Synonyms:
  • 1,2-Ethanediamine, 1-(2-bromophenyl)-, (S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.