CAS 113974-28-0

1,2-Ethanediamine, 1-(2-bromophenyl)-, (R)-

Description:

1,2-Ethanediamine, 1-(2-bromophenyl)-, (R)-, with the CAS number 113974-28-0, is a chiral organic compound characterized by the presence of both an amine functional group and a bromophenyl substituent. This compound features a two-carbon ethylene backbone with two amine groups (-NH2) attached to the first carbon, and a brominated phenyl group attached to the second carbon. The presence of the bromine atom introduces significant reactivity and can influence the compound's physical properties, such as solubility and boiling point. As a chiral molecule, it exists in two enantiomeric forms, with the (R)- configuration being one of them, which can have implications in biological activity and interactions. This compound may be utilized in various applications, including pharmaceuticals and organic synthesis, due to its potential as a building block in the development of more complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₈H₁₁BrN₂

InChI: InChI=1S/C8H11BrN2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8H,5,10-11H2/t8-/m0/s1

InChI key: InChIKey=PAMGDOWWTHYUTI-QMMMGPOBSA-N

SMILES: [C@@H](CN)(N)C1=C(Br)C=CC=C1

Synonyms:

• 1,2-Ethanediamine, 1-(2-bromophenyl)-, (R)-