CAS 113975-22-7
:2-fluoro-3-iodopyridine
Description:
2-Fluoro-3-iodopyridine is a heterocyclic organic compound characterized by the presence of both fluorine and iodine substituents on a pyridine ring. The molecular structure features a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, with the fluorine atom located at the second position and the iodine atom at the third position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits moderate polarity due to the electronegative halogen atoms, which can influence its reactivity and solubility in various solvents. 2-Fluoro-3-iodopyridine is of interest in medicinal chemistry and materials science, as the presence of halogens can enhance biological activity and facilitate further chemical modifications. Additionally, its unique structure allows for potential applications in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of novel materials. Safety precautions should be taken when handling this compound, as it may pose health risks associated with halogenated organic substances.
Formula:C5H3FIN
InChI:InChI=1/C5H3FIN/c6-5-4(7)2-1-3-8-5/h1-3H
SMILES:c1cc(c(F)nc1)I
Synonyms:- 2-Fluor-3-iodpyridin
- Pyridine, 2-fluoro-3-iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyridine, 2-fluoro-3-iodo-
CAS:Formula:C5H3FINPurity:97%Color and Shape:SolidMolecular weight:222.9869Ref: IN-DA000A84
10kgTo inquire500gTo inquire250mg24.00€1g27.00€5g30.00€10g43.00€25g64.00€100g189.00€2-Fluoro-3-iodopyridine
CAS:Formula:C5H3FINPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:222.992-Fluoro-3-iodopyridine
CAS:2-Fluoro-3-iodopyridineFormula:C5H3FINPurity:98%Color and Shape: off-white to faint yellow crystalline needlesMolecular weight:222.99g/mol2-Fluoro-3-iodopyridine
CAS:Formula:C5H3FINPurity:97%Color and Shape:Solid, Low Melting SolidMolecular weight:222.989




