CAS 113975-37-4

1H-Pyrrolo[3,2-c]pyridine,2-methyl-(9CI)

Description:

1H-Pyrrolo[3,2-c]pyridine, 2-methyl- (CAS 113975-37-4) is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyrrole and pyridine structures. This compound features a methyl group at the 2-position of the pyrrolo ring, which can influence its chemical reactivity and biological activity. Typically, compounds of this class exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the ring systems contributes to their basicity and potential for forming coordination complexes. Additionally, 1H-Pyrrolo[3,2-c]pyridine derivatives may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the pyrrole component. The compound's solubility, stability, and reactivity can vary based on the specific substituents and the overall molecular structure. Overall, this compound represents a valuable scaffold for the development of new therapeutic agents and materials in organic synthesis.

Formula: C₈H₈N₂

InChI: InChI=1/C8H8N2/c1-6-4-7-5-9-3-2-8(7)10-6/h2-5,10H,1H3

SMILES: Cc1cc2cnccc2[nH]1

Synonyms:

• 2-methyl-1H-pyrrolo[3,2-c]pyridine

2-Methyl-1H-pyrrolo[3,2-c]pyridine

CAS: 113975-37-4

Formula: C₈H₈N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 132.1625

Ref: IN-DA000A7Y

2-Methyl-1H-pyrrolo[3,2-c]pyridine

CAS: 113975-37-4

Formula: C₈H₈N₂

Purity: 95.0%

Color and Shape: Solid, Tan powder

Molecular weight: 132.166

Ref: 10-F208799

2-Methyl-5-azaindole

Controlled Product

CAS: 113975-37-4

Formula: C₈H₈N₂

Color and Shape: Neat

Molecular weight: 132.162

Ref: TR-M288660