CAS 113975-75-0
:HYDROXYIMINO-(1H-INDOL-3-YL)-ACETIC ACID METHYL ESTER
Description:
Hydroxyimino-(1H-indol-3-yl)-acetic acid methyl ester, with the CAS number 113975-75-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a hydroxyimino functional group, which is indicative of its potential reactivity and ability to participate in various chemical reactions, such as condensation and nucleophilic addition. The presence of the methyl ester group suggests that it can undergo hydrolysis to yield the corresponding acid, which may have implications for its biological activity. Hydroxyimino compounds are often studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. The indole moiety is known for its significance in many natural products and pharmaceuticals, contributing to the compound's potential therapeutic applications. Overall, this compound's unique structural features and functional groups make it a subject of interest in medicinal chemistry and organic synthesis.
Formula:C11H10N2O3
InChI:InChI=1/C11H10N2O3/c1-16-11(14)10(13-15)8-6-12-9-5-3-2-4-7(8)9/h2-6,12,15H,1H3/b13-10-
SMILES:COC(=O)/C(=N\O)/c1c[nH]c2ccccc12
Synonyms:- 1H-Indole-3-acetic acid, alpha-(hydroxyimino)-, methyl ester, (alphaZ)-
- Methyl (2Z)-(hydroxyimino)(1H-indol-3-yl)acetate
- methyl (2Z)-(hydroxyimino)(1H-indol-3-yl)ethanoate
- Hydroxyimino-(1H-indole-3-yl)-acetic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Hydroxyimino-(1h-indol-3-yl)-acetic acid methyl ester
CAS:Formula:C11H10N2O3Molecular weight:218.2087Alpha-(Hydroxyimino)-1H-indole-3-acetic Acid Methyl Ester
CAS:Controlled ProductApplications α-(Hydroxyimino)-1H-indole-3-acetic Acid Methyl Ester (cas# 113975-75-0) is a compound useful in organic synthesis.
Formula:C11H10N2O3Color and Shape:NeatMolecular weight:218.21

