CAS 113981-49-0
:7-O-Methyldihydrowogonin
Description:
7-O-Methyldihydrowogonin is a flavonoid compound derived from the plant genus *Scutellaria*, known for its potential pharmacological properties. This substance features a methoxy group at the 7-position of the dihydrowogonin structure, which contributes to its biological activity. Flavonoids, including 7-O-Methyldihydrowogonin, are characterized by their polyphenolic structure, which typically includes two aromatic rings and a heterocyclic ring. This compound is recognized for its antioxidant properties, which may help in neutralizing free radicals and reducing oxidative stress. Additionally, it has been studied for its potential anti-inflammatory, neuroprotective, and anticancer effects, although further research is needed to fully elucidate its mechanisms of action and therapeutic applications. The compound is soluble in organic solvents, and its stability can be influenced by factors such as pH and temperature. As with many natural products, the extraction and purification processes can affect its yield and purity, making standardization important for research and potential medicinal use.
Formula:C17H16O5
InChI:InChI=1S/C17H16O5/c1-20-14-9-12(19)15-11(18)8-13(10-6-4-3-5-7-10)22-17(15)16(14)21-2/h3-7,9,13,19H,8H2,1-2H3/t13-/m0/s1
InChI key:InChIKey=VPGMCCIECGDASG-ZDUSSCGKSA-N
SMILES:O(C)C1=C2C(C(=O)C[C@H](O2)C3=CC=CC=C3)=C(O)C=C1OC
Synonyms:- 7-O-Methyldihydrowogonin
- (2S)-2,3-Dihydro-5-hydroxy-7,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5-hydroxy-7,8-dimethoxy-2-phenyl-, (2S)-
- (2S)-5-Hydroxy-7,8-dimethoxyflavanone
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5-hydroxy-7,8-dimethoxy-2-phenyl-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4H-1-Benzopyran-4-one, 2,3-dihydro-5-hydroxy-7,8-dimethoxy-2-phenyl-, (2S)-
CAS:Formula:C17H16O5Purity:98.0%Molecular weight:300.30595-Hydroxy-7,8-dimethoxyflavanone
CAS:5-Hydroxy-7,8-dimethoxyflavanone is isolated from Andrographis paniculata Nees. leaves and roots with anti-inflammatory activity.Formula:C17H16O5Purity:98%Color and Shape:SolidMolecular weight:300.315-Hydroxy-7,8-dimethoxyflavanone
CAS:Formula:C17H16O5Purity:95%~99%Color and Shape:PowderMolecular weight:300.315-Hydroxy-7,8-dimethoxyflavanone
CAS:5-Hydroxy-7,8-dimethoxyflavanone is a naturally occurring flavanone, which is typically sourced from various plant species known for their bioactive compounds. This compound falls under the category of flavonoids and exhibits distinct structural features that contribute to its biochemical activities. The source plants for this flavanone are often part of traditional medicinal systems, owing to their rich profile of secondary metabolites.
Formula:C17H16O5Purity:Min. 95%Molecular weight:300.3 g/mol



