
CAS 1139837-37-8
:(2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid
Description:
The chemical substance known as (2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid, with the CAS number 1139837-37-8, is a complex organic compound characterized by its unique structural features. It contains a heptenoic acid backbone, which includes a double bond at the second position and a hydroxyl group at the sixth position, indicating its potential reactivity and biological significance. The presence of a 3,6-dideoxy-α-L-arabino-hexopyranosyl moiety suggests that this compound may exhibit glycosidic properties, potentially influencing its solubility and interaction with biological systems. This compound may be of interest in the fields of medicinal chemistry and biochemistry due to its structural complexity and potential biological activities. Its stereochemistry, particularly the (2E,6R) configuration, plays a crucial role in determining its reactivity and interactions with other molecules. Overall, this substance exemplifies the intricate relationship between structure and function in organic compounds.
Formula:C13H22O6
InChI:InChI=1S/C13H22O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h4,6,8-11,13-15H,3,5,7H2,1-2H3,(H,16,17)/b6-4+/t8-,9+,10-,11-,13-/m1/s1
InChI key:InChIKey=GGHOMCWJOMBZEK-LHYQPRBASA-N
SMILES:O([C@@H](CC/C=C/C(O)=O)C)[C@H]1[C@H](O)C[C@@H](O)[C@H](C)O1
Synonyms:- (2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid
- 2-Heptenoic acid, 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-, (2E,6R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ascr#7
CAS:Ascr#7, a hormone in nematodes, initiates dauer larvae formation, enhancing their lifespan and stress resistance.Formula:C13H22O6Color and Shape:SolidMolecular weight:274.313
