CAS 1139837-37-8

(2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid

Description:

The chemical substance known as (2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid, with the CAS number 1139837-37-8, is a complex organic compound characterized by its unique structural features. It contains a heptenoic acid backbone, which includes a double bond at the second position and a hydroxyl group at the sixth position, indicating its potential reactivity and biological significance. The presence of a 3,6-dideoxy-α-L-arabino-hexopyranosyl moiety suggests that this compound may exhibit glycosidic properties, potentially influencing its solubility and interaction with biological systems. This compound may be of interest in the fields of medicinal chemistry and biochemistry due to its structural complexity and potential biological activities. Its stereochemistry, particularly the (2E,6R) configuration, plays a crucial role in determining its reactivity and interactions with other molecules. Overall, this substance exemplifies the intricate relationship between structure and function in organic compounds.

Formula: C₁₃H₂₂O₆

InChI: InChI=1S/C13H22O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h4,6,8-11,13-15H,3,5,7H2,1-2H3,(H,16,17)/b6-4+/t8-,9+,10-,11-,13-/m1/s1

InChI key: InChIKey=GGHOMCWJOMBZEK-LHYQPRBASA-N

SMILES: O([C@@H](CC/C=C/C(O)=O)C)[C@H]1[C@H](O)C[C@@H](O)[C@H](C)O1

Synonyms:

• (2E,6R)-6-[(3,6-Dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-heptenoic acid
• 2-Heptenoic acid, 6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-, (2E,6R)-

Ascr#7

CAS: 1139837-37-8

Ascr#7, a hormone in nematodes, initiates dauer larvae formation, enhancing their lifespan and stress resistance.

Formula: C₁₃H₂₂O₆

Color and Shape: Solid

Molecular weight: 274.313

Ref: TM-T38515