CAS 113985-34-5
:Pyridine, 4-methyl-2-(2-propenyl)- (9CI)
Description:
Pyridine, 4-methyl-2-(2-propenyl)-, also known by its CAS number 113985-34-5, is an organic compound that belongs to the class of pyridines, which are heterocyclic aromatic compounds containing a nitrogen atom in the ring. This particular compound features a methyl group and a propenyl group attached to the pyridine ring, contributing to its unique chemical properties. It is characterized by a distinct aromatic structure, which imparts stability and influences its reactivity. Pyridine derivatives are often used as solvents, in the synthesis of pharmaceuticals, and as intermediates in organic reactions. The presence of the nitrogen atom in the ring enhances its basicity compared to non-nitrogen-containing aromatic compounds. Additionally, the propenyl group can participate in various chemical reactions, making this compound versatile in synthetic organic chemistry. Its physical properties, such as boiling point and solubility, can vary based on the specific substituents and their positions on the pyridine ring. Overall, this compound is of interest in both industrial applications and research settings.
Formula:C9H11N
InChI:InChI=1/C9H11N/c1-3-4-9-7-8(2)5-6-10-9/h3,5-7H,1,4H2,2H3
SMILES:C=CCc1cc(C)ccn1
Synonyms:- 2-Allyl-4-Methyl-Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.