CAS 113994-36-8

2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3-pyridinecarboxylic acid ethyl ester

Description:

2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3-pyridinecarboxylic acid ethyl ester, with CAS number 113994-36-8, is a chemical compound that belongs to the class of pyridinecarboxylic acid esters. This compound features a pyridine ring substituted with various functional groups, including an ethyl ester and an aminoethoxy side chain, which contribute to its potential biological activity. The presence of a chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes. The aminoethoxy group may facilitate hydrogen bonding and enhance solubility in polar solvents. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyridine structure can lead to varied pharmacological properties. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be evaluated for its efficacy in biological assays. Safety and handling precautions should be observed due to the presence of chlorine and other reactive functional groups.

Formula: C₁₈H₂₁ClN₂O₃

InChI: InChI=1/C18H21ClN2O3/c1-3-24-18(22)17-14(13-6-4-5-7-15(13)19)10-12(2)21-16(17)11-23-9-8-20/h4-7,10H,3,8-9,11,20H2,1-2H3

SMILES: CCOC(=O)c1c(cc(C)nc1COCCN)c1ccccc1Cl

Synonyms:

• Amlodipine related compound A

Ethyl 2-((2-aminoethoxy)methyl)-4-(2-chlorophenyl)-6-methylnicotinate

CAS: 113994-36-8

Formula: C₁₈H₂₁ClN₂O₃

Molecular weight: 348.8239

Ref: IN-DA007QXZ

Ethyl 2-​((2-​Aminoethoxy)​methyl)​-​4-​(2-​chlorophenyl)​-​6-​methylnicotinate

Controlled Product

CAS: 113994-36-8

Formula: C₁₈H₂₁ClN₂O₃

Color and Shape: Neat

Molecular weight: 348.824

Ref: TR-E899830