CAS 113994-38-0

2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic acid 3-ethyl ester

Description:

2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic acid 3-ethyl ester, with CAS number 113994-38-0, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with multiple functional groups. This compound features a pyridine backbone with two carboxylic acid ester groups, contributing to its potential as a bioactive molecule. The presence of a 2-chlorophenyl group and an aminoethoxy side chain suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The ester functionality may influence its solubility and reactivity, while the amino group can participate in hydrogen bonding, enhancing its pharmacological properties. Additionally, the methyl groups on the pyridine ring can affect the compound's steric and electronic characteristics, potentially influencing its biological activity. Overall, this compound's unique structural features may provide avenues for research in drug development and therapeutic applications.

Formula: C₁₉H₂₁ClN₂O₅

InChI: InChI=1/C19H21ClN2O5/c1-3-27-19(25)17-14(10-26-9-8-21)22-11(2)15(18(23)24)16(17)12-6-4-5-7-13(12)20/h4-7H,3,8-10,21H2,1-2H3,(H,23,24)

SMILES: CCOC(=O)c1c(COCCN)nc(C)c(c1c1ccccc1Cl)C(=O)O

Synonyms:

• Amlodipine related compound B