CAS 113996-89-7

N,O-bis(allyldimethylsilyl)-2,2,2-trifluoroacetamide

Description:

N,O-bis(allyldimethylsilyl)-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes both silyl and trifluoroacetamide functional groups. This compound typically exhibits properties associated with both organosilicon and fluorinated compounds, such as enhanced thermal stability and potential hydrophobicity due to the presence of fluorine atoms. The allyldimethylsilyl groups contribute to its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in chemical reactions. The trifluoroacetamide moiety can influence the compound's solubility and polarity, affecting its behavior in different solvents. Additionally, this compound may exhibit interesting interactions with biological systems, which could be relevant in medicinal chemistry. Overall, N,O-bis(allyldimethylsilyl)-2,2,2-trifluoroacetamide is a versatile compound with potential applications in materials science and organic synthesis, although specific handling and safety considerations should be observed due to its chemical nature.

Formula: C₁₂H₂₄F₃NOSi₂

InChI: InChI=1/C12H24F3NOSi2/c1-7-9-18(3,4)16-11(12(13,14)15)17-19(5,6)10-8-2/h7-8,11,16H,1-2,9-10H2,3-6H3

SMILES: C=CC[Si](C)(C)NC(C(F)(F)F)O[Si](C)(C)CC=C

Synonyms:

• Bastfa
• N-(1-{[dimethyl(prop-2-en-1-yl)silyl]oxy}-2,2,2-trifluoroethyl)-1,1-dimethyl-1-(prop-2-en-1-yl)silanamine
• N,O-Bis(allyldimethylsilyl)-2,2,2-trifluoroacetamide