CAS 114-03-4
:(±)-5-Hydroxytryptophan
Description:
(±)-5-Hydroxytryptophan, commonly known as 5-HTP, is an amino acid and a naturally occurring compound that serves as a precursor to serotonin, a key neurotransmitter involved in mood regulation. It is an indoleamine, characterized by its structure that includes an indole ring and a hydroxyl group attached to the fifth carbon of the tryptophan backbone. This compound is typically derived from the seeds of the African plant Griffonia simplicifolia and is often used as a dietary supplement for its potential effects on mood enhancement, sleep improvement, and appetite regulation. The "(±)" designation indicates that the substance is a racemic mixture, containing both the D- and L- enantiomers, which may exhibit different biological activities. In terms of solubility, 5-HTP is generally soluble in water and exhibits stability under normal storage conditions. Its pharmacological effects are attributed to its ability to cross the blood-brain barrier and increase serotonin levels in the brain, making it a subject of interest in the study of depression and anxiety disorders.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)
InChI key:InChIKey=LDCYZAJDBXYCGN-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C=1C=2C(NC1)=CC=C(O)C2
Synonyms:- 5-Hydroxytryptophan
- Tryptophan, 5-hydroxy-
- 5-Hydroxytryptophane
- 5-HTP
- (±)-5-Hydroxytryptophan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
