CAS 114-27-2
:5,6,7,8-Tetrahydro-6,7-dimethylpteridine
Description:
5,6,7,8-Tetrahydro-6,7-dimethylpteridine, with the CAS number 114-27-2, is a bicyclic organic compound that belongs to the pteridine family. It is characterized by a fused ring structure that includes a pyrimidine and a pyrazine moiety, contributing to its unique chemical properties. This compound is typically a pale yellow to white solid and is soluble in polar organic solvents. It is known for its role as a precursor in the synthesis of various biologically active molecules, including certain vitamins and pharmaceuticals. The presence of methyl groups at the 6 and 7 positions enhances its stability and reactivity, making it a valuable intermediate in organic synthesis. Additionally, 5,6,7,8-Tetrahydro-6,7-dimethylpteridine may exhibit biological activity, although specific applications can vary. Its structural features allow for potential interactions with biological systems, which can be explored in medicinal chemistry and drug development. Overall, this compound is significant in both synthetic and biological chemistry contexts.
Formula:C8H12N4
InChI:InChI=1S/C8H12N4/c1-5-6(2)12-8-7(11-5)3-9-4-10-8/h3-6,11H,1-2H3,(H,9,10,12)
InChI key:InChIKey=CALVHBWWYCZXKE-UHFFFAOYSA-N
SMILES:CC1NC=2C(NC1C)=NC=NC2
Synonyms:- Pteridine, 5,6,7,8-tetrahydro-6,7-dimethyl-
- 6,7-Dimethyl-5,6,7,8-tetrahydropteridine
- 5,6,7,8-Tetrahydro-6,7-dimethylpteridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
