CAS 1140-28-9
:2′-Nitro[1,1′-biphenyl]-4-amine
Description:
2′-Nitro[1,1′-biphenyl]-4-amine, with the CAS number 1140-28-9, is an organic compound characterized by the presence of a nitro group and an amino group attached to a biphenyl structure. This compound typically appears as a solid and is known for its aromatic properties due to the biphenyl framework. The nitro group (-NO2) is a strong electron-withdrawing group, which can influence the reactivity and stability of the compound, while the amino group (-NH2) is a strong electron-donating group, contributing to its basicity. The presence of these functional groups makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data indicates that it should be handled with care, as nitro compounds can be hazardous. Overall, 2′-Nitro[1,1′-biphenyl]-4-amine serves as a valuable compound in both synthetic organic chemistry and materials science.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14(15)16/h1-8H,13H2
InChI key:InChIKey=RAKGZQHZUMWEFW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)C2=CC=C(N)C=C2
Synonyms:- 1953-38-4ANLG 4-amino-2'-nitrobiphenyl
- 2'-Nitro-4-biphenylamine
- 2'-Nitrobiphenyl-4-Amine
- 2′-Nitro-4-aminobiphenyl
- 2′-Nitro-biphenyl-4-ylamine
- 2′-Nitro[1,1′-biphenyl]-4-amine
- 4-Amino-2'-nitrobiphenyl
- 4-Biphenylamine, 2'-nitro-
- Brn 2806470
- [1,1′-Biphenyl]-4-amine, 2′-nitro-
- 3-12-00-03199 (Beilstein Handbook Reference)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
