
CAS 1140-36-9
:3-(4-Bromophenyl)-2,1-benzisoxazole
Description:
3-(4-Bromophenyl)-2,1-benzisoxazole, with the CAS number 1140-36-9, is an organic compound characterized by its unique structure that combines a benzisoxazole moiety with a bromophenyl group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the bromine atom enhances its reactivity and can influence its interaction with biological targets. The compound is generally soluble in organic solvents, which is common for many aromatic compounds, but may have limited solubility in water. Its molecular structure contributes to its electronic properties, making it a candidate for studies in materials science and organic electronics. Additionally, the compound's stability and reactivity can vary depending on environmental conditions such as temperature and pH. Overall, 3-(4-Bromophenyl)-2,1-benzisoxazole is of interest for its potential utility in various chemical and biological applications.
Formula:C13H8BrNO
InChI:InChI=1S/C13H8BrNO/c14-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)15-16-13/h1-8H
InChI key:InChIKey=SHCCGVDBBQECPF-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=C3C(=NO2)C=CC=C3)C=C1
Synonyms:- 3-(4-Bromophenyl)-2,1-benzisoxazole
- 2,1-Benzisoxazole, 3-(p-bromophenyl)-
- 2,1-Benzisoxazole, 3-(4-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
