
CAS 1140-37-0
:1-(5-Chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)ethanone
Description:
1-(5-Chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)ethanone, with the CAS number 1140-37-0, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 5-position and a methyl group at the 3-position of the pyrazole ring, along with a phenyl group at the 1-position. The presence of the ethanone functional group indicates that it contains a carbonyl (C=O) moiety, contributing to its reactivity and potential applications in organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure suggests potential biological activity, making it of interest in medicinal chemistry. Additionally, the presence of chlorine may influence its electronic properties and reactivity, which can be relevant in various chemical reactions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C12H11ClN2O
InChI:InChI=1S/C12H11ClN2O/c1-8-11(9(2)16)12(13)15(14-8)10-6-4-3-5-7-10/h3-7H,1-2H3
InChI key:InChIKey=QKWRIGZJEGWRJK-UHFFFAOYSA-N
SMILES:ClC=1N(N=C(C)C1C(C)=O)C2=CC=CC=C2
Synonyms:- 1-(5-Chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)ethan-1-one
- 1-(5-Chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)ethanone
- Ketone, 5-chloro-3-methyl-1-phenylpyrazol-4-yl methyl
- 1-(5-Chloro-3-methyl-1-phenylpyrazol-4-yl)ethanone
- Ethanone, 1-(5-chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanone, 1-(5-chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)-
CAS:Formula:C12H11ClN2OMolecular weight:234.6815
