CAS 114012-40-7
:2,2-Bis(chloromethyl)butanoyl chloride
Description:
2,2-Bis(chloromethyl)butanoyl chloride, with the CAS number 114012-40-7, is an organic compound characterized by its structure, which includes a butanoyl chloride moiety and two chloromethyl groups attached to the second carbon of the butane chain. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent acylating agent. It is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. The chloromethyl groups enhance its electrophilic character, allowing it to participate in various chemical reactions, including nucleophilic acyl substitution and polymerization processes. Due to its reactivity, it must be handled with care, as it can be corrosive and may pose health hazards upon exposure. Its applications may include use in organic synthesis, particularly in the preparation of more complex molecules or polymers.
Formula:C6H9Cl3O
InChI:InChI=1S/C6H9Cl3O/c1-2-6(3-7,4-8)5(9)10/h2-4H2,1H3
InChI key:InChIKey=SYCZDXISDNISHW-UHFFFAOYSA-N
SMILES:C(C(Cl)=O)(CC)(CCl)CCl
Synonyms:- Butanoyl chloride, 2,2-bis(chloromethyl)-
- 2,2-Bis(chloromethyl)butanoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
