CAS 114012-41-8
:3-oxetanecarboxylic acid
Description:
3-Oxetanecarboxylic acid, also known as 3-oxetanecarboxylic acid, is a cyclic carboxylic acid characterized by a four-membered ring structure containing an oxygen atom and a carboxylic acid functional group. This compound features a unique combination of ring strain due to its small ring size and the presence of the carboxylic acid group, which can influence its reactivity and stability. It is typically a colorless liquid or solid at room temperature and is soluble in polar solvents due to its ability to form hydrogen bonds. The presence of the oxetane ring contributes to its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting properties such as reactivity in ring-opening reactions, making it a valuable intermediate in various chemical processes. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would need to be determined through experimental data or literature for precise applications.
Formula:C4H6O3
InChI:InChI=1/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6)
SMILES:C1C(CO1)C(=O)O
Synonyms:- Oxetane-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Oxetane-3-carboxylic acid, 95%
CAS:<p>Oxetane-3-carboxylic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the lega</p>Formula:C4H6O3Purity:95%Color and Shape:Pale yellow, LiquidMolecular weight:102.09Oxetane-3-carboxylic acid
CAS:<p>Oxetane-3-carboxylic acid</p>Formula:C4H6O3Purity:98%Color and Shape: off-white to light yellow solid- liquidMolecular weight:102.08864g/molOxetane-3-carboxylic Acid
CAS:Formula:C4H6O3Purity:>93.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:102.09
