CAS 114014-32-3

N-[2-(Triethoxysilyl)ethyl]urea

Description:

N-[2-(Triethoxysilyl)ethyl]urea, with the CAS number 114014-32-3, is a silane coupling agent that features both organic and inorganic components, making it valuable in various applications, particularly in materials science and surface modification. This compound contains a urea functional group, which contributes to its reactivity and ability to form hydrogen bonds, enhancing adhesion properties. The triethoxysilyl group allows for covalent bonding to silica surfaces, promoting compatibility between organic polymers and inorganic substrates. Typically, it appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its characteristics include good thermal stability and the ability to improve the mechanical properties of composite materials. Additionally, it can act as a crosslinking agent in polymer formulations, enhancing durability and resistance to environmental factors. Due to its unique structure, N-[2-(Triethoxysilyl)ethyl]urea is utilized in coatings, adhesives, and sealants, where it plays a crucial role in improving adhesion and overall performance of the final products.

Formula: C₉H₂₂N₂O₄Si

InChI: InChI=1S/C9H22N2O4Si/c1-4-13-16(14-5-2,15-6-3)8-7-11-9(10)12/h4-8H2,1-3H3,(H3,10,11,12)

InChI key: InChIKey=ZCEAVTLUHHSQTE-UHFFFAOYSA-N

SMILES: [Si](CCNC(N)=O)(OCC)(OCC)OCC

Synonyms:

• Urea, N-[2-(triethoxysilyl)ethyl]-
• N-[2-(Triethoxysilyl)ethyl]urea
• Urea, [2-(triethoxysilyl)ethyl]-

Urea, N-[2-(triethoxysilyl)ethyl]-

CAS: 114014-32-3

Formula: C₉H₂₂N₂O₄Si

Molecular weight: 250.3675

Ref: IN-DA000ABG