CAS 1140239-91-3

Thieno[3,2-c]pyridine-4-carboxylic acid

Description:

Thieno[3,2-c]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group at the 4-position of the pyridine ring, enhancing its reactivity and solubility in polar solvents. The presence of the thieno ring introduces additional electron-rich characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Thieno[3,2-c]pyridine derivatives are of interest in medicinal chemistry due to their biological activity, including potential applications in anti-inflammatory and anti-cancer therapies. The compound's molecular structure allows for interactions with biological targets, which can be explored in drug design. Additionally, its stability and reactivity can be influenced by substituents on the rings, making it a versatile scaffold for further chemical modifications. Overall, Thieno[3,2-c]pyridine-4-carboxylic acid is a significant compound in organic synthesis and pharmaceutical research.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)7-5-2-4-12-6(5)1-3-9-7/h1-4H,(H,10,11)

InChI key: InChIKey=AQYOGXPFIQCXKH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(SC=C2)=CC=N1

Synonyms:

• Thieno[3,2-c]pyridine-4-carboxylic acid