CAS 1140239-96-8

Methyl 1H-pyrazolo[4,3-c]pyridine-4-carboxylate

Description:

Methyl 1H-pyrazolo[4,3-c]pyridine-4-carboxylate is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in medicinal chemistry. It typically appears as a crystalline solid and is soluble in organic solvents, reflecting its polar nature due to the presence of the carboxylate group. The compound is of interest in various fields, including pharmaceuticals, where it may serve as a scaffold for the development of bioactive molecules. Its unique structure allows for potential interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of the methyl ester group enhances its lipophilicity, which can influence its pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may vary.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-13-8(12)7-5-4-10-11-6(5)2-3-9-7/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=VWWRQOHUTDDIKQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC=N1)NN=C2

Synonyms:

• 1H-Pyrazolo[4,3-c]pyridine-4-carboxylic acid, methyl ester
• Methyl 1H-pyrazolo[4,3-c]pyridine-4-carboxylate

1H-Pyrazolo[4,3-c]pyridine-4-carboxylic acid, methyl ester

CAS: 1140239-96-8

Formula: C₈H₇N₃O₂

Purity: 97%

Molecular weight: 177.1601

Ref: IN-DA000ABQ