
CAS 1140240-24-9
:4-Ethyl-1H-pyrrolo[3,2-c]pyridine
Description:
4-Ethyl-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an ethyl group attached to the pyrrole nitrogen, influencing its reactivity and solubility. It typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. The presence of both nitrogen atoms in the ring structure imparts basicity and potential for hydrogen bonding, making it a candidate for various chemical reactions, including electrophilic substitutions. Its structural configuration allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound may exhibit interesting electronic properties, making it relevant in materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Ethyl-1H-pyrrolo[3,2-c]pyridine represents a versatile compound with significant implications in both research and industrial applications.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c1-2-8-7-3-5-11-9(7)4-6-10-8/h3-6,11H,2H2,1H3
InChI key:InChIKey=GBAJCCMNCVYTNC-UHFFFAOYSA-N
SMILES:C(C)C1=C2C(NC=C2)=CC=N1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine, 4-ethyl-
- 4-Ethyl-1H-pyrrolo[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
