CAS 1140241-24-2
:6-(Chloromethyl)-3-pyridinamine
Description:
6-(Chloromethyl)-3-pyridinamine, with the CAS number 1140241-24-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) attached to the sixth position of the pyridine ring and an amino group (-NH2) at the third position, contributing to its reactivity and potential applications in organic synthesis. The presence of both the chloromethyl and amino groups makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the amino group, making it a candidate for further chemical modifications. Safety data should be consulted for handling, as chlorinated compounds can pose health risks.
Formula:C6H7ClN2
InChI:InChI=1S/C6H7ClN2/c7-3-6-2-1-5(8)4-9-6/h1-2,4H,3,8H2
InChI key:InChIKey=YIRHFXGPFBXWCV-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC=C(N)C=N1
Synonyms:- 3-Pyridinamine, 6-(chloromethyl)-
- 6-(Chloromethyl)-3-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.