CymitQuimica logo

CAS 114037-86-4

:

N-[4-(1,2,2-Tricyanoethyl)phenyl]acetamide

Description:
N-[4-(1,2,2-Tricyanoethyl)phenyl]acetamide, identified by its CAS number 114037-86-4, is an organic compound characterized by its unique structure that includes a phenyl ring substituted with a tricyanoethyl group and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and cyano functionalities, which can influence its reactivity and solubility. The presence of the cyano groups suggests potential for strong electron-withdrawing effects, which can enhance the compound's reactivity in various chemical reactions, including nucleophilic additions. Additionally, the acetamide moiety may impart some degree of hydrogen bonding capability, affecting its physical properties such as melting point and solubility in polar solvents. The compound may also exhibit interesting electronic properties, making it a candidate for applications in materials science, particularly in the development of organic semiconductors or dyes. Overall, its unique structural features contribute to its potential utility in various chemical and industrial applications.
Formula:C13H10N4O
InChI:InChI=1S/C13H10N4O/c1-9(18)17-12-4-2-10(3-5-12)13(8-16)11(6-14)7-15/h2-5,11,13H,1H3,(H,17,18)
InChI key:InChIKey=TVMSAGKNBZXZEM-UHFFFAOYSA-N
SMILES:C(C(C#N)C#N)(C#N)C1=CC=C(NC(C)=O)C=C1
Synonyms:
  • N-[4-(1,2,2-Tricyanoethyl)phenyl]acetamide
  • Acetamide, N-[4-(1,2,2-tricyanoethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.