CAS 114040-50-5
:3,4-DIFLUORO-BENZAMIDINE
Description:
3,4-Difluoro-benzamidine is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms at the 3 and 4 positions, along with an amidine functional group. This compound typically exhibits properties associated with both aromatic and amidine functionalities, such as potential hydrogen bonding and increased polarity due to the electronegative fluorine atoms. The presence of fluorine can enhance the compound's stability and influence its reactivity, making it of interest in various chemical applications, including medicinal chemistry and material science. 3,4-Difluoro-benzamidine may also exhibit biological activity, potentially serving as a scaffold for the development of pharmaceuticals. Its synthesis generally involves the introduction of fluorine substituents onto a benzamide precursor, followed by amidine formation. As with many fluorinated compounds, it may display unique solubility and partitioning characteristics, which can affect its behavior in biological systems and its utility in drug design. Safety and handling precautions should be observed due to the potential toxicity of fluorinated compounds.
Formula:C7H6F2N2
InChI:InChI=1/C7H6F2N2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H3,10,11)
SMILES:c1cc(c(cc1C(=N)N)F)F
Synonyms:- Benzenecarboximidamide, 3,4-Difluoro-
- 3,4-Difluorobenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-Difluorobenzene-1-carboximidamide
CAS:<p>3,4-Difluorobenzene-1-carboximidamide</p>Molecular weight:156.13275g/mol


