CymitQuimica logo

CAS 114041-34-8

:

1-(9-acetyl-6-chloro-9H-carbazol-2-yl)-2-chloropropan-1-one

Description:
1-(9-acetyl-6-chloro-9H-carbazol-2-yl)-2-chloropropan-1-one, with the CAS number 114041-34-8, is a synthetic organic compound characterized by its complex structure, which includes a carbazole moiety. This compound features a chloro-substituent and an acetyl group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the chloropropanone functional group suggests that it may participate in nucleophilic substitution reactions, making it a versatile intermediate in the synthesis of various chemical entities. Additionally, the carbazole framework is known for its photophysical properties, which may lend the compound potential utility in electronic materials or as a fluorescent probe. Its unique combination of functional groups may also impart biological activity, warranting investigation for pharmacological applications. As with many chlorinated compounds, considerations regarding its environmental impact and safety profile are essential for handling and usage in research and industrial settings.
Formula:C17H13Cl2NO2
InChI:InChI=1/C17H13Cl2NO2/c1-9(18)17(22)11-3-5-13-14-8-12(19)4-6-15(14)20(10(2)21)16(13)7-11/h3-9H,1-2H3
SMILES:CC(C(=O)c1ccc2c3cc(ccc3n(C(=O)C)c2c1)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.