CAS 114041-35-9
:1-(6-chloro-9H-carbazol-2-yl)-1,1-dimethoxypropan-2-ol
Description:
1-(6-chloro-9H-carbazol-2-yl)-1,1-dimethoxypropan-2-ol, with the CAS number 114041-35-9, is a chemical compound characterized by its complex structure, which includes a carbazole moiety and a propanol derivative. The presence of the chloro group on the carbazole ring contributes to its potential reactivity and biological activity. This compound features two methoxy groups, which can influence its solubility and polarity, making it more amenable to various chemical reactions. The hydroxyl group in the propanol part of the molecule adds to its functionality, allowing for hydrogen bonding and potential interactions with biological systems. Such characteristics may render it useful in medicinal chemistry, particularly in the development of pharmaceuticals or as a research tool in studying biological pathways. Additionally, the compound's unique structure may impart specific optical or electronic properties, making it of interest in materials science or organic electronics. Overall, its diverse functional groups and structural features suggest a range of potential applications in various fields of chemistry.
Formula:C17H18ClNO3
InChI:InChI=1/C17H18ClNO3/c1-10(20)17(21-2,22-3)11-4-6-13-14-9-12(18)5-7-15(14)19-16(13)8-11/h4-10,19-20H,1-3H3
SMILES:CC(C(c1ccc2c3cc(ccc3[nH]c2c1)Cl)(OC)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Chloro-β,β-dimethoxy-α-methyl-9H-carbazole-2-ethanol
CAS:Formula:C17H18ClNO3Molecular weight:319.7827

