CAS 114041-77-9
:(3S)-3-Amino-2-butanone
Description:
(3S)-3-Amino-2-butanone, with the CAS number 114041-77-9, is an organic compound characterized by its amino and carbonyl functional groups. It is a chiral molecule, meaning it has a specific spatial arrangement of atoms that results in non-superimposable mirror images. This compound typically exists as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in water and polar organic solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and biochemistry, as it may serve as an intermediate in the synthesis of more complex molecules or as a building block in the development of bioactive compounds. Its reactivity is influenced by the amino and carbonyl groups, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C4H9NO
InChI:InChI=1S/C4H9NO/c1-3(5)4(2)6/h3H,5H2,1-2H3/t3-/m0/s1
InChI key:InChIKey=OLYWGXUJESDUAC-VKHMYHEASA-N
SMILES:[C@@H](C(C)=O)(C)N
Synonyms:- 2-Butanone, 3-amino-, (S)-
- 2-Butanone, 3-amino-, (3S)-
- (3S)-3-Amino-2-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
