CAS 114042-02-3

5-bromo-3-methyl-2-nitropyridine

Description:

5-Bromo-3-methyl-2-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position, a methyl group at the 3-position, and a nitro group at the 2-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is soluble in organic solvents. It exhibits reactivity due to the electron-withdrawing nature of the nitro group, which can influence its behavior in electrophilic substitution reactions. The bromine substituent can also participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity. Overall, 5-bromo-3-methyl-2-nitropyridine serves as an important building block in the synthesis of various organic compounds.

Formula: C₆H₅BrN₂O₂

InChI: InChI=1S/C6H5BrN2O2/c1-4-2-5(7)3-8-6(4)9(10)11/h2-3H,1H3

SMILES: Cc1cc(cnc1N(=O)=O)Br

Pyridine, 5-bromo-3-methyl-2-nitro-

CAS: 114042-02-3

Formula: C₆H₅BrN₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 217.0201

Ref: IN-DA000AD2

5-Bromo-3-methyl-2-nitropyridine

CAS: 114042-02-3

5-Bromo-3-methyl-2-nitropyridine

Purity: 97%

Molecular weight: 217.02g/mol

Ref: 54-OR73776

5-Bromo-3-methyl-2-nitropyridine

CAS: 114042-02-3

Formula: C₆H₅BrN₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 217.022

Ref: 10-F335401