CAS 114042-03-4
:3-Methyl-5-phenyl-2-pyridinamine
Description:
3-Methyl-5-phenyl-2-pyridinamine, with the CAS number 114042-03-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a phenyl group attached to the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. The presence of the amino group (-NH2) suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-9-7-11(8-14-12(9)13)10-5-3-2-4-6-10/h2-8H,1H3,(H2,13,14)
InChI key:InChIKey=WVUDWMVFKOHVGR-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1N)C2=CC=CC=C2
Synonyms:- 3-Methyl-5-phenyl-2-pyridinamine
- 2-Pyridinamine, 3-methyl-5-phenyl-
- 2-Amino-3-methyl-5-phenylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
