
CAS 114042-93-2
:4-Methyl-6-propyl-2-pyrimidinamine
Description:
4-Methyl-6-propyl-2-pyrimidinamine, identified by its CAS number 114042-93-2, is an organic compound belonging to the class of pyrimidines, which are six-membered heterocyclic compounds containing nitrogen atoms. This particular compound features a pyrimidine ring substituted with a methyl group at the 4-position and a propyl group at the 6-position, along with an amino group at the 2-position. The presence of these substituents influences its chemical properties, including its solubility, reactivity, and potential biological activity. Typically, pyrimidine derivatives are known for their roles in pharmaceuticals and agrochemicals, often exhibiting various biological activities. The compound may be characterized by its melting point, boiling point, and spectral data such as NMR and IR, which provide insights into its molecular structure and functional groups. Additionally, its stability, reactivity with other chemicals, and potential applications in medicinal chemistry or as a building block in organic synthesis are areas of interest for further exploration.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c1-3-4-7-5-6(2)10-8(9)11-7/h5H,3-4H2,1-2H3,(H2,9,10,11)
InChI key:InChIKey=VOUGFDYHXGXWFT-UHFFFAOYSA-N
SMILES:C(CC)C=1C=C(C)N=C(N)N1
Synonyms:- 2-Pyrimidinamine, 4-methyl-6-propyl-
- 2-Amino-6-methyl-4-propylpyrimidine
- 4-Methyl-6-propyl-2-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.