CAS 114044-17-6

2-[2-(10-Hydroxy-9-phenanthrenyl)diazenyl]benzoic acid

Description:

2-[2-(10-Hydroxy-9-phenanthrenyl)diazenyl]benzoic acid, with the CAS number 114044-17-6, is a chemical compound characterized by its azo structure, which features a diazenyl group (-N=N-) linking two aromatic systems. This compound exhibits notable properties due to the presence of both hydroxyl and carboxylic acid functional groups, contributing to its potential solubility in polar solvents and its ability to participate in hydrogen bonding. The phenanthrene moiety provides significant aromatic character, which can influence its electronic properties and stability. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for applications in dyes, pigments, or as a fluorescent probe. Its structural features suggest potential reactivity in various chemical reactions, including coupling reactions or as a ligand in coordination chemistry. Overall, this compound's unique combination of functional groups and aromatic systems positions it as a versatile substance in both synthetic and applied chemistry contexts.

Formula: C₂₁H₁₄N₂O₃

InChI: InChI=1S/C21H14N2O3/c24-20-16-10-4-2-8-14(16)13-7-1-3-9-15(13)19(20)23-22-18-12-6-5-11-17(18)21(25)26/h1-12,24H,(H,25,26)

InChI key: InChIKey=ZBFWQUSTBHUUBP-UHFFFAOYSA-N

SMILES: N(=NC1=C(C(O)=O)C=CC=C1)C2=C3C(=C4C(=C2O)C=CC=C4)C=CC=C3

Synonyms:

• Benzoic acid, 2-[2-(10-hydroxy-9-phenanthrenyl)diazenyl]-
• Benzoic acid, 2-[(10-hydroxy-9-phenanthrenyl)azo]-
• 10-(2-Carboxyphenylazo)-9-phenanthrenol
• 10-(2-Carboxylphenylazo)-9-phenanthrol
• 2-[2-(10-Hydroxy-9-phenanthrenyl)diazenyl]benzoic acid

Benzoic acid, 2-[2-(10-hydroxy-9-phenanthrenyl)diazenyl]-

CAS: 114044-17-6

Formula: C₂₁H₁₄N₂O₃

Molecular weight: 342.3475

Ref: IN-DA000AE5