
CAS 1140462-05-0
:Methyl 2′-methyl-2-(trifluoromethyl)biphenyl-4-carboxylate
Description:
Methyl 2′-methyl-2-(trifluoromethyl)biphenyl-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group and a trifluoromethyl group on the biphenyl framework contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or hydrolysis. This compound may exhibit interesting thermal stability and solubility characteristics due to the influence of the trifluoromethyl group, which is known to enhance the stability and reactivity of organic molecules. Additionally, the presence of fluorine atoms can impart unique electronic properties, making it a candidate for applications in pharmaceuticals, agrochemicals, or materials science. Overall, its structural features suggest potential utility in various chemical and industrial applications, although specific reactivity and toxicity profiles would require further investigation.
Formula:C16H13F3O2
InChI:InChI=1S/C16H13F3O2/c1-10-5-3-4-6-12(10)13-8-7-11(15(20)21-2)9-14(13)16(17,18)19/h3-9H,1-2H3
InChI key:InChIKey=FPYOTPGYISYHLH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC(C(OC)=O)=C1)C2=C(C)C=CC=C2
Synonyms:- Methyl 2′-methyl-2-(trifluoromethyl)biphenyl-4-carboxylate
- [1,1′-Biphenyl]-4-carboxylic acid, 2′-methyl-2-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.