
CAS 114058-73-0
:N2,N2-Dimethyl-2,7-quinolinediamine
Description:
N2,N2-Dimethyl-2,7-quinolinediamine, with the CAS number 114058-73-0, is an organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two methyl groups attached to the nitrogen atoms at the 2 and 7 positions of the quinoline ring, contributing to its unique properties. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific formulation and conditions. The presence of amino groups in its structure suggests potential reactivity, particularly in forming hydrogen bonds and participating in various chemical reactions, such as nucleophilic substitutions or complexation with metal ions. Additionally, compounds of this type may have applications in fields such as medicinal chemistry, materials science, or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-14(2)11-6-4-8-3-5-9(12)7-10(8)13-11/h3-7H,12H2,1-2H3
InChI key:InChIKey=OBEALMFLLAAYAO-UHFFFAOYSA-N
SMILES:N(C)(C)C1=NC2=C(C=C1)C=CC(N)=C2
Synonyms:- 2-N,2-N-Dimethylquinoline-2,7-diamine
- 2,7-Quinolinediamine, N2,N2-dimethyl-
- 2,7-Quinolinediamine N2,N2-dimethyl-
- N2,N2-Dimethyl-2,7-quinolinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.