CAS 114058-91-2
:5-(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL
Description:
5-(4-Fluorophenyl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity. This compound features a thiol (-SH) functional group, which is known for its reactivity and ability to form disulfide bonds, making it significant in various chemical and biological processes. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, as triazoles are commonly used in these contexts. Additionally, the fluorine atom can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Its solubility, stability, and reactivity can vary based on environmental conditions, making it important to consider these factors in practical applications. Overall, 5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol is a versatile compound with potential utility in medicinal chemistry and related fields.
Formula:C8H6FN3S
InChI:InChI=1/C8H6FN3S/c9-6-3-1-5(2-4-6)7-10-8(13)12-11-7/h1-4H,(H2,10,11,12,13)
InChI key:InChIKey=YJFTVTOWNFZLSW-UHFFFAOYSA-N
SMILES:S=C1NC(C2=CC=C(F)C=C2)=NN1
Synonyms:- 3H-1,2,4-Triazole-3-thione, 5-(4-fluorophenyl)-1,2-dihydro-
- 5-(4-Fluorophenyl)-1,2,4-triazole-3-thiol
- 5-(4-Fluorophenyl)-1,2-dihydro-3H-1,2,4-triazole-3-thione
- 5-(4-Fluorophenyl)-1H-1,2,4-triazole-3-thiol
- Chembrdg-Bb 4012401
- 4H-1,2,4-triazole-3-thiol, 5-(4-fluorophenyl)-
- 5-(4-FLUOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL
- 5-(4-fluorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione
- 5-(4-fluorophenyl)-4H-1,2,4-triazole-3-thiol(SALTDATA: FREE)
- 2,4-Dihydro-5-(4-fluorophenyl)-3H-1,2,4-triazole-3-thione
- 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-(4-Fluorophenyl)-4H-1,2,4-triazole-3-thiol
CAS:5-(4-Fluorophenyl)-4H-1,2,4-triazole-3-thiol
Molecular weight:195.21674g/mol


