CymitQuimica logo

CAS 114065-37-1

:

1,2,4-Oxadiazol-5-amine,3-(1,1-dimethylethyl)-(9CI)

Description:
1,2,4-Oxadiazol-5-amine, 3-(1,1-dimethylethyl)-, commonly referred to by its CAS number 114065-37-1, is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features an amine functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of a tert-butyl group (1,1-dimethylethyl) enhances its steric properties, influencing its solubility and stability. Typically, compounds of this nature are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. The oxadiazole moiety is known for its role in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety and handling considerations should be observed, as with any chemical substance, to mitigate risks associated with exposure or reactivity.
Formula:C6H11N3O
InChI:InChI=1S/C6H11N3O/c1-6(2,3)4-8-5(7)10-9-4/h1-3H3,(H2,7,8,9)
InChI key:ILUUSWWGUOPVLO-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=NOC(=N1)N
Found 5 products.