CymitQuimica logo

CAS 114072-04-7

:

1H-Pyrazino[2,3-c][1,2,6]thiadiazine, 2,2-dioxide

Description:
1H-Pyrazino[2,3-c][1,2,6]thiadiazine, 2,2-dioxide, is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both nitrogen and sulfur atoms. This compound features a pyrazine ring fused with a thiadiazine moiety, which contributes to its distinctive chemical properties. The presence of the 2,2-dioxide functional group indicates that it contains two oxygen atoms double-bonded to the sulfur atom, enhancing its reactivity and potential for forming various derivatives. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, which can lead to pharmacological effects. Additionally, the compound's solubility, stability, and reactivity can vary based on the substituents attached to the core structure. Overall, 1H-Pyrazino[2,3-c][1,2,6]thiadiazine, 2,2-dioxide represents a class of compounds that may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C5H4N4O2S
InChI:InChI=1S/C5H4N4O2S/c10-12(11)8-3-4-5(9-12)7-2-1-6-4/h1-3H,(H,7,9)
InChI key:InChIKey=UTCXNNLFDANWQK-UHFFFAOYSA-N
SMILES:O=S1(=O)N=C2C(C=N1)=NC=CN2
Synonyms:
  • 1H-Pyrazino[2,3-c][1,2,6]thiadiazine, 2,2-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.