CymitQuimica logo

CAS 114079-51-5

:

1-Propanone, 2-(methylamino)-1-(4-morpholinyl)-

Description:
1-Propanone, 2-(methylamino)-1-(4-morpholinyl)-, also known by its CAS number 114079-51-5, is a chemical compound characterized by its ketone functional group and the presence of both a methylamino and a morpholine moiety. This compound typically exhibits a polar nature due to the presence of the ketone and amino groups, which can influence its solubility in various solvents, often making it soluble in polar solvents like water and alcohols. The morpholine ring contributes to its potential biological activity, as morpholines are known for their versatility in medicinal chemistry. The compound may exhibit properties such as moderate volatility and a specific reactivity profile, making it of interest in pharmaceutical applications. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. However, safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c1-7(9-2)8(11)10-3-5-12-6-4-10/h7,9H,3-6H2,1-2H3
InChI key:InChIKey=NZAGUCFNBGHDII-UHFFFAOYSA-N
SMILES:C(C(NC)C)(=O)N1CCOCC1
Synonyms:
  • Morpholine, 4-[2-(methylamino)-1-oxopropyl]-, (±)-
  • 1-Propanone, 2-(methylamino)-1-(4-morpholinyl)-
  • 2-(Methylamino)-1-(morpholin-4-yl)propan-1-one
  • Morpholine, 4-[2-(methylamino)-1-oxopropyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.