CAS 114080-93-2

Isoxazolo[4,5-b]pyridin-3-amine (9CI)

Description:

Isoxazolo[4,5-b]pyridin-3-amine, with the CAS number 114080-93-2, is a heterocyclic compound that features a fused isoxazole and pyridine ring system. This compound is characterized by its unique bicyclic structure, which contributes to its potential biological activity. Isoxazoles are known for their role in medicinal chemistry, often exhibiting various pharmacological properties, including anti-inflammatory and antimicrobial effects. The presence of an amino group at the 3-position of the pyridine ring enhances its reactivity and solubility, making it a valuable scaffold in drug design. The compound's molecular structure allows for interactions with biological targets, which can lead to the development of novel therapeutic agents. Additionally, its stability and reactivity can be influenced by substituents on the rings, making it a versatile compound for further chemical modifications. Overall, Isoxazolo[4,5-b]pyridin-3-amine represents an interesting area of study in the field of organic and medicinal chemistry.

Formula: C₆H₅N₃O

InChI: InChI=1/C6H5N3O/c7-6-5-4(10-9-6)2-1-3-8-5/h1-3H,(H2,7,9)

SMILES: c1cc2c(c(=N)[nH]o2)nc1

Synonyms:

• [1,2]Oxazolo[4,5-b]pyridin-3-amine
• Isoxazolo[4,5-b]pyridin-3-amine
• 3-AMino-isoxazolo[4,5-b]pyridine

isoxazolo[4,5-b]pyridin-3-amine

CAS: 114080-93-2

Formula: C₆H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA000AIA

Isoxazolo[4,5-b]pyridin-3-amine

CAS: 114080-93-2

Isoxazolo[4,5-b]pyridin-3-amine

Purity: 98%

Molecular weight: 135.12g/mol

Ref: 54-OR906109

Isoxazolo[4,5-b]pyridin-3-amine

CAS: 114080-93-2

Formula: C₆H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 135.126

Ref: 10-F079566