CAS 114080-94-3

Isoxazolo[5,4-c]pyridin-3-amine

Description:

Isoxazolo[5,4-c]pyridin-3-amine is a heterocyclic compound characterized by the presence of both isoxazole and pyridine rings in its structure. This compound features a five-membered isoxazole ring fused to a six-membered pyridine ring, with an amino group (-NH2) located at the 3-position of the pyridine. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. Isoxazolo[5,4-c]pyridin-3-amine may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects can vary based on structural modifications and the presence of substituents. Its molecular structure allows for various interactions with biological targets, which can be explored in drug development. Additionally, the compound's solubility, stability, and reactivity are influenced by the electronic and steric effects of the isoxazole and pyridine moieties. Overall, Isoxazolo[5,4-c]pyridin-3-amine represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₆H₅N₃O

InChI: InChI=1S/C6H5N3O/c7-6-4-1-2-8-3-5(4)10-9-6/h1-3H,(H2,7,9)

InChI key: InChIKey=YDWPZZKCLZOZDR-UHFFFAOYSA-N

SMILES: NC=1C=2C(=CN=CC2)ON1

Synonyms:

• (Isoxazolo[5,4-c]pyridin-3-yl)amine
• Isoxazolo[5,4-c]pyridin-3-amine
• [1,2]Oxazolo[5,4-c]pyridin-3-amine

isoxazolo[5,4-c]pyridin-3-amine

CAS: 114080-94-3

Formula: C₆H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA000AI9

Isoxazolo[5,4-c]pyridin-3-amine

CAS: 114080-94-3

Isoxazolo[5,4-c]pyridin-3-amine

Purity: 97%

Molecular weight: 135.12g/mol

Ref: 54-OR959629

Isoxazolo[5,4-c]pyridin-3-amine

CAS: 114080-94-3

Formula: C₆H₅N₃O

Purity: 98%

Molecular weight: 135.126

Ref: 10-F376971

Isoxazolo[5,4-c]pyridin-3-amine

CAS: 114080-94-3

Isoxazolo[5,4-c]pyridin-3-amine is an inhibitor of fatty acid amide hydrolase (FAAH), a metabolic enzyme that catalyzes the hydrolysis of the endogenous fatty acid amides. This inhibition results in increased levels of endocannabinoids, which are known to reduce pain and inflammation. Isoxazolo[5,4-c]pyridin-3-amine has been shown to be effective against a number of FAAH inhibitors, including other inhibitors such as URB597 and JZL184. These compounds have also been shown to produce analgesic effects in mice by inhibiting the production of proinflammatory cytokines such as tumor necrosis factor α (TNFα) and IL-1β.

Formula: C₆H₅N₃O

Purity: Min. 95%

Molecular weight: 135.12 g/mol

Ref: 3D-PEA08094